C12H9ClN4 — CID 14391780
5-chloro-N-phenyl-1H-imidazo[4,5-b]pyridin-7-amine (PubChem CID 14391780) has the molecular formula C12H9ClN4 and a molecular weight of 244.69 g/mol. Its IUPAC name is 5-chloro-N-phenyl-1H-imidazo[4,5-b]pyridin-7-amine.
| Compound Name | 5-chloro-N-phenyl-1H-imidazo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 14391780 |
| Molecular Formula | C12H9ClN4 |
| Molecular Weight | 244.69 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 5-chloro-N-phenyl-1H-imidazo[4,5-b]pyridin-7-amine |
| SMILES | Clc1cc(Nc2ccccc2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H9ClN4/c13-10-6-9(11-12(17-10)15-7-14-11)16-8-4-2-1-3-5-8/h1-7H,(H2,14,15,16,17) |
| InChIKey | HWIXIVXZAMEFMO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.69 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|