C9H7N3O4 — CID 156713395
7-methoxy-3-nitro-1H-1,8-naphthyridin-4-one (PubChem CID 156713395) has the molecular formula C9H7N3O4 and a molecular weight of 221.17 g/mol. Its IUPAC name is 7-methoxy-3-nitro-1H-1,8-naphthyridin-4-one.
| Compound Name | 7-methoxy-3-nitro-1H-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 156713395 |
| Molecular Formula | C9H7N3O4 |
| Molecular Weight | 221.17 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 7-methoxy-3-nitro-1H-1,8-naphthyridin-4-one |
| SMILES | COc1ccc2c(=O)c([N+](=O)[O-])c[nH]c2n1 |
| InChI | InChI=1S/C9H7N3O4/c1-16-7-3-2-5-8(13)6(12(14)15)4-10-9(5)11-7/h2-4H,1H3,(H,10,11,13) |
| InChIKey | LWQCPHVEAVLIGX-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.17 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|