C8H6FN5O2 — CID 7103331
7-fluoro-6-nitroquinazoline-2,4-diamine (PubChem CID 7103331) has the molecular formula C8H6FN5O2 and a molecular weight of 223.17 g/mol. Its IUPAC name is 7-fluoro-6-nitroquinazoline-2,4-diamine.
| Compound Name | 7-fluoro-6-nitroquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 7103331 |
| Molecular Formula | C8H6FN5O2 |
| Molecular Weight | 223.17 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 7-fluoro-6-nitroquinazoline-2,4-diamine |
| SMILES | Nc1nc(N)c2cc([N+](=O)[O-])c(F)cc2n1 |
| InChI | InChI=1S/C8H6FN5O2/c9-4-2-5-3(1-6(4)14(15)16)7(10)13-8(11)12-5/h1-2H,(H4,10,11,12,13) |
| InChIKey | OWEWOOGZKCQWHW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.17 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|