C12H7FN4O3S — CID 103332258
4-(3-fluoro-4-nitrophenoxy)thieno[2,3-d]pyrimidin-2-amine (PubChem CID 103332258) has the molecular formula C12H7FN4O3S and a molecular weight of 306.28 g/mol. Its IUPAC name is 4-(3-fluoro-4-nitrophenoxy)thieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-(3-fluoro-4-nitrophenoxy)thieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103332258 |
| Molecular Formula | C12H7FN4O3S |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 4-(3-fluoro-4-nitrophenoxy)thieno[2,3-d]pyrimidin-2-amine |
| SMILES | Nc1nc(Oc2ccc([N+](=O)[O-])c(F)c2)c2ccsc2n1 |
| InChI | InChI=1S/C12H7FN4O3S/c13-8-5-6(1-2-9(8)17(18)19)20-10-7-3-4-21-11(7)16-12(14)15-10/h1-5H,(H2,14,15,16) |
| InChIKey | YDSBBZPJUICKKZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|