C12H7ClFN3OS — CID 103333492
4-(3-chloro-2-fluorophenoxy)thieno[2,3-d]pyrimidin-2-amine (PubChem CID 103333492) has the molecular formula C12H7ClFN3OS and a molecular weight of 295.73 g/mol. Its IUPAC name is 4-(3-chloro-2-fluorophenoxy)thieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-(3-chloro-2-fluorophenoxy)thieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103333492 |
| Molecular Formula | C12H7ClFN3OS |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | 4-(3-chloro-2-fluorophenoxy)thieno[2,3-d]pyrimidin-2-amine |
| SMILES | Nc1nc(Oc2cccc(Cl)c2F)c2ccsc2n1 |
| InChI | InChI=1S/C12H7ClFN3OS/c13-7-2-1-3-8(9(7)14)18-10-6-4-5-19-11(6)17-12(15)16-10/h1-5H,(H2,15,16,17) |
| InChIKey | DLKXLYYZFRNAIT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |