C13H15FO4 — CID 117388525
2-[2-(cyclobutylmethoxy)-5-fluorophenyl]-2-hydroxyacetic acid (PubChem CID 117388525) has the molecular formula C13H15FO4 and a molecular weight of 254.26 g/mol. Its IUPAC name is 2-[2-(cyclobutylmethoxy)-5-fluorophenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[2-(cyclobutylmethoxy)-5-fluorophenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 117388525 |
| Molecular Formula | C13H15FO4 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 2-[2-(cyclobutylmethoxy)-5-fluorophenyl]-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1cc(F)ccc1OCC1CCC1 |
| InChI | InChI=1S/C13H15FO4/c14-9-4-5-11(18-7-8-2-1-3-8)10(6-9)12(15)13(16)17/h4-6,8,12,15H,1-3,7H2,(H,16,17) |
| InChIKey | VMJLJGFIVWCATL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |