C11H8F3NO4 — CID 171871175
2-(2-cyano-1,2-dihydroxyethyl)-5-(trifluoromethyl)benzoic acid (PubChem CID 171871175) has the molecular formula C11H8F3NO4 and a molecular weight of 275.18 g/mol. Its IUPAC name is 2-(2-cyano-1,2-dihydroxyethyl)-5-(trifluoromethyl)benzoic acid.
| Compound Name | 2-(2-cyano-1,2-dihydroxyethyl)-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 171871175 |
| Molecular Formula | C11H8F3NO4 |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 2-(2-cyano-1,2-dihydroxyethyl)-5-(trifluoromethyl)benzoic acid |
| SMILES | N#CC(O)C(O)c1ccc(C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C11H8F3NO4/c12-11(13,14)5-1-2-6(7(3-5)10(18)19)9(17)8(16)4-15/h1-3,8-9,16-17H,(H,18,19) |
| InChIKey | RXMZPYVDVIOQMC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|