C11H11ClF2O4 — CID 171894379
3-(4-chloro-1,2-dihydroxybutyl)-2,6-difluorobenzoic acid (PubChem CID 171894379) has the molecular formula C11H11ClF2O4 and a molecular weight of 280.65 g/mol. Its IUPAC name is 3-(4-chloro-1,2-dihydroxybutyl)-2,6-difluorobenzoic acid.
| Compound Name | 3-(4-chloro-1,2-dihydroxybutyl)-2,6-difluorobenzoic acid |
|---|---|
| PubChem CID | 171894379 |
| Molecular Formula | C11H11ClF2O4 |
| Molecular Weight | 280.65 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 3-(4-chloro-1,2-dihydroxybutyl)-2,6-difluorobenzoic acid |
| SMILES | O=C(O)c1c(F)ccc(C(O)C(O)CCCl)c1F |
| InChI | InChI=1S/C11H11ClF2O4/c12-4-3-7(15)10(16)5-1-2-6(13)8(9(5)14)11(17)18/h1-2,7,10,15-16H,3-4H2,(H,17,18) |
| InChIKey | GRGMPIXIPPBNSG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.65 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|