C12H15ClO4 — CID 171894105
3-(4-chloro-1,2-dihydroxybutyl)-4-methylbenzoic acid (PubChem CID 171894105) has the molecular formula C12H15ClO4 and a molecular weight of 258.70 g/mol. Its IUPAC name is 3-(4-chloro-1,2-dihydroxybutyl)-4-methylbenzoic acid.
| Compound Name | 3-(4-chloro-1,2-dihydroxybutyl)-4-methylbenzoic acid |
|---|---|
| PubChem CID | 171894105 |
| Molecular Formula | C12H15ClO4 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 3-(4-chloro-1,2-dihydroxybutyl)-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1C(O)C(O)CCCl |
| InChI | InChI=1S/C12H15ClO4/c1-7-2-3-8(12(16)17)6-9(7)11(15)10(14)4-5-13/h2-3,6,10-11,14-15H,4-5H2,1H3,(H,16,17) |
| InChIKey | SVUUMJKNTLPDSG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|