C12H16O3S — CID 170820216
1-[3-(1,2-dihydroxy-3-sulfanylpropyl)-4-methylphenyl]ethanone (PubChem CID 170820216) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is 1-[3-(1,2-dihydroxy-3-sulfanylpropyl)-4-methylphenyl]ethanone.
| Compound Name | 1-[3-(1,2-dihydroxy-3-sulfanylpropyl)-4-methylphenyl]ethanone |
|---|---|
| PubChem CID | 170820216 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 1-[3-(1,2-dihydroxy-3-sulfanylpropyl)-4-methylphenyl]ethanone |
| SMILES | CC(=O)c1ccc(C)c(C(O)C(O)CS)c1 |
| InChI | InChI=1S/C12H16O3S/c1-7-3-4-9(8(2)13)5-10(7)12(15)11(14)6-16/h3-5,11-12,14-16H,6H2,1-2H3 |
| InChIKey | BJHDGIYCZBNZBJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|