C11H14FNO3 — CID 170828348
1-[3-(3-amino-1,2-dihydroxypropyl)-4-fluorophenyl]ethanone (PubChem CID 170828348) has the molecular formula C11H14FNO3 and a molecular weight of 227.23 g/mol. Its IUPAC name is 1-[3-(3-amino-1,2-dihydroxypropyl)-4-fluorophenyl]ethanone.
| Compound Name | 1-[3-(3-amino-1,2-dihydroxypropyl)-4-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 170828348 |
| Molecular Formula | C11H14FNO3 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 1-[3-(3-amino-1,2-dihydroxypropyl)-4-fluorophenyl]ethanone |
| SMILES | CC(=O)c1ccc(F)c(C(O)C(O)CN)c1 |
| InChI | InChI=1S/C11H14FNO3/c1-6(14)7-2-3-9(12)8(4-7)11(16)10(15)5-13/h2-4,10-11,15-16H,5,13H2,1H3 |
| InChIKey | YANWMNPIEONMCM-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |