C17H16N4O3 — CID 170827065
4-(3-azido-1,2-dihydroxypropyl)-2-phenylmethoxybenzonitrile (PubChem CID 170827065) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 4-(3-azido-1,2-dihydroxypropyl)-2-phenylmethoxybenzonitrile.
| Compound Name | 4-(3-azido-1,2-dihydroxypropyl)-2-phenylmethoxybenzonitrile |
|---|---|
| PubChem CID | 170827065 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 4-(3-azido-1,2-dihydroxypropyl)-2-phenylmethoxybenzonitrile |
| SMILES | N#Cc1ccc(C(O)C(O)CN=[N+]=[N-])cc1OCc1ccccc1 |
| InChI | InChI=1S/C17H16N4O3/c18-9-14-7-6-13(17(23)15(22)10-20-21-19)8-16(14)24-11-12-4-2-1-3-5-12/h1-8,15,17,22-23H,10-11H2 |
| InChIKey | UVJFAGMVMLSFAI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|