C16H17ClO4 — CID 171863217
3-chloro-1-(4-hydroxy-3-phenylmethoxyphenyl)propane-1,2-diol (PubChem CID 171863217) has the molecular formula C16H17ClO4 and a molecular weight of 308.76 g/mol. Its IUPAC name is 3-chloro-1-(4-hydroxy-3-phenylmethoxyphenyl)propane-1,2-diol.
| Compound Name | 3-chloro-1-(4-hydroxy-3-phenylmethoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 171863217 |
| Molecular Formula | C16H17ClO4 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 3-chloro-1-(4-hydroxy-3-phenylmethoxyphenyl)propane-1,2-diol |
| SMILES | Oc1ccc(C(O)C(O)CCl)cc1OCc1ccccc1 |
| InChI | InChI=1S/C16H17ClO4/c17-9-14(19)16(20)12-6-7-13(18)15(8-12)21-10-11-4-2-1-3-5-11/h1-8,14,16,18-20H,9-10H2 |
| InChIKey | OZATVQAMLGXBCS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|