C10H13N3O2 — CID 104853648
1-[(1S)-1-azidoethyl]-2,4-dimethoxybenzene (PubChem CID 104853648) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 1-[(1S)-1-azidoethyl]-2,4-dimethoxybenzene.
| Compound Name | 1-[(1S)-1-azidoethyl]-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 104853648 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 1-[(1S)-1-azidoethyl]-2,4-dimethoxybenzene |
| SMILES | COc1ccc([C@H](C)N=[N+]=[N-])c(OC)c1 |
| InChI | InChI=1S/C10H13N3O2/c1-7(12-13-11)9-5-4-8(14-2)6-10(9)15-3/h4-7H,1-3H3/t7-/m0/s1 |
| InChIKey | JJIBRUICWUWSKZ-ZETCQYMHSA-N |
| XLogP | 3.08 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|