C15H25NO2 — CID 66438971
3-(2,4-dimethoxyphenyl)-N-propylbutan-2-amine (PubChem CID 66438971) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-N-propylbutan-2-amine.
| Compound Name | 3-(2,4-dimethoxyphenyl)-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 66438971 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-N-propylbutan-2-amine |
| SMILES | CCCNC(C)C(C)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C15H25NO2/c1-6-9-16-12(3)11(2)14-8-7-13(17-4)10-15(14)18-5/h7-8,10-12,16H,6,9H2,1-5H3 |
| InChIKey | FIROSAHDHNKDIA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |