C17H29NO2 — CID 43496056
1-(2,4-dimethoxyphenyl)-2-methyl-N-propylpentan-1-amine (PubChem CID 43496056) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-2-methyl-N-propylpentan-1-amine.
| Compound Name | 1-(2,4-dimethoxyphenyl)-2-methyl-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 43496056 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-2-methyl-N-propylpentan-1-amine |
| SMILES | CCCNC(c1ccc(OC)cc1OC)C(C)CCC |
| InChI | InChI=1S/C17H29NO2/c1-6-8-13(3)17(18-11-7-2)15-10-9-14(19-4)12-16(15)20-5/h9-10,12-13,17-18H,6-8,11H2,1-5H3 |
| InChIKey | NUMBUFWBLZBWNK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |