C10H12N6O — CID 58764698
1,3-bis(azidomethyl)-2-methoxy-5-methylbenzene (PubChem CID 58764698) has the molecular formula C10H12N6O and a molecular weight of 232.25 g/mol. Its IUPAC name is 1,3-bis(azidomethyl)-2-methoxy-5-methylbenzene.
| Compound Name | 1,3-bis(azidomethyl)-2-methoxy-5-methylbenzene |
|---|---|
| PubChem CID | 58764698 |
| Molecular Formula | C10H12N6O |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 1,3-bis(azidomethyl)-2-methoxy-5-methylbenzene |
| SMILES | COc1c(CN=[N+]=[N-])cc(C)cc1CN=[N+]=[N-] |
| InChI | InChI=1S/C10H12N6O/c1-7-3-8(5-13-15-11)10(17-2)9(4-7)6-14-16-12/h3-4H,5-6H2,1-2H3 |
| InChIKey | GGZJPLORDTXODM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 106.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|