C10H13F4N3O3 — CID 167696388
5-(azidomethyl)-1,2,3-trimethoxybenzene;molecular fluorine (PubChem CID 167696388) has the molecular formula C10H13F4N3O3 and a molecular weight of 299.22 g/mol. Its IUPAC name is 5-(azidomethyl)-1,2,3-trimethoxybenzene;molecular fluorine.
| Compound Name | 5-(azidomethyl)-1,2,3-trimethoxybenzene;molecular fluorine |
|---|---|
| PubChem CID | 167696388 |
| Molecular Formula | C10H13F4N3O3 |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 5-(azidomethyl)-1,2,3-trimethoxybenzene;molecular fluorine |
| SMILES | COc1cc(CN=[N+]=[N-])cc(OC)c1OC.FF.FF |
| InChI | InChI=1S/C10H13N3O3.2F2/c1-14-8-4-7(6-12-13-11)5-9(15-2)10(8)16-3;2*1-2/h4-5H,6H2,1-3H3;; |
| InChIKey | XSGIAXMVWMUUSY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|