C18H22N2O3 — CID 91105164
(2-ethylphenyl)-[(3,4,5-trimethoxyphenyl)methyl]diazene (PubChem CID 91105164) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is (2-ethylphenyl)-[(3,4,5-trimethoxyphenyl)methyl]diazene.
| Compound Name | (2-ethylphenyl)-[(3,4,5-trimethoxyphenyl)methyl]diazene |
|---|---|
| PubChem CID | 91105164 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (2-ethylphenyl)-[(3,4,5-trimethoxyphenyl)methyl]diazene |
| SMILES | CCc1ccccc1/N=N/Cc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C18H22N2O3/c1-5-14-8-6-7-9-15(14)20-19-12-13-10-16(21-2)18(23-4)17(11-13)22-3/h6-11H,5,12H2,1-4H3/b20-19+ |
| InChIKey | IAWDEJUQMZQZAM-FMQUCBEESA-N |
| XLogP | 4.56 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|