C12H16ClN3O2S — CID 114173858
5-chloro-6-(2-thiomorpholin-4-ylethylamino)pyridine-3-carboxylic acid (PubChem CID 114173858) has the molecular formula C12H16ClN3O2S and a molecular weight of 301.80 g/mol. Its IUPAC name is 5-chloro-6-(2-thiomorpholin-4-ylethylamino)pyridine-3-carboxylic acid.
| Compound Name | 5-chloro-6-(2-thiomorpholin-4-ylethylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 114173858 |
| Molecular Formula | C12H16ClN3O2S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 5-chloro-6-(2-thiomorpholin-4-ylethylamino)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnc(NCCN2CCSCC2)c(Cl)c1 |
| InChI | InChI=1S/C12H16ClN3O2S/c13-10-7-9(12(17)18)8-15-11(10)14-1-2-16-3-5-19-6-4-16/h7-8H,1-6H2,(H,14,15)(H,17,18) |
| InChIKey | YSGFOQBRWLGBOX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |