C10H14Cl2N4S — CID 106326689
2,5-dichloro-N-(2-thiomorpholin-4-ylethyl)pyrimidin-4-amine (PubChem CID 106326689) has the molecular formula C10H14Cl2N4S and a molecular weight of 293.22 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-thiomorpholin-4-ylethyl)pyrimidin-4-amine.
| Compound Name | 2,5-dichloro-N-(2-thiomorpholin-4-ylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106326689 |
| Molecular Formula | C10H14Cl2N4S |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 2,5-dichloro-N-(2-thiomorpholin-4-ylethyl)pyrimidin-4-amine |
| SMILES | Clc1ncc(Cl)c(NCCN2CCSCC2)n1 |
| InChI | InChI=1S/C10H14Cl2N4S/c11-8-7-14-10(12)15-9(8)13-1-2-16-3-5-17-6-4-16/h7H,1-6H2,(H,13,14,15) |
| InChIKey | GWEWTADSAHCOHZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |