C13H21ClN4S — CID 114173942
6-chloro-5-propyl-N-(2-thiomorpholin-4-ylethyl)pyrimidin-4-amine (PubChem CID 114173942) has the molecular formula C13H21ClN4S and a molecular weight of 300.86 g/mol. Its IUPAC name is 6-chloro-5-propyl-N-(2-thiomorpholin-4-ylethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-5-propyl-N-(2-thiomorpholin-4-ylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114173942 |
| Molecular Formula | C13H21ClN4S |
| Molecular Weight | 300.86 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 6-chloro-5-propyl-N-(2-thiomorpholin-4-ylethyl)pyrimidin-4-amine |
| SMILES | CCCc1c(Cl)ncnc1NCCN1CCSCC1 |
| InChI | InChI=1S/C13H21ClN4S/c1-2-3-11-12(14)16-10-17-13(11)15-4-5-18-6-8-19-9-7-18/h10H,2-9H2,1H3,(H,15,16,17) |
| InChIKey | VWEQEDKFDYOEFQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.86 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |