C11H12ClN5O3 — CID 167932861
5-chloro-6-[2-[4-(hydroxymethyl)triazol-1-yl]ethylamino]pyridine-3-carboxylic acid (PubChem CID 167932861) has the molecular formula C11H12ClN5O3 and a molecular weight of 297.70 g/mol. Its IUPAC name is 5-chloro-6-[2-[4-(hydroxymethyl)triazol-1-yl]ethylamino]pyridine-3-carboxylic acid.
| Compound Name | 5-chloro-6-[2-[4-(hydroxymethyl)triazol-1-yl]ethylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 167932861 |
| Molecular Formula | C11H12ClN5O3 |
| Molecular Weight | 297.70 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 5-chloro-6-[2-[4-(hydroxymethyl)triazol-1-yl]ethylamino]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnc(NCCn2cc(CO)nn2)c(Cl)c1 |
| InChI | InChI=1S/C11H12ClN5O3/c12-9-3-7(11(19)20)4-14-10(9)13-1-2-17-5-8(6-18)15-16-17/h3-5,18H,1-2,6H2,(H,13,14)(H,19,20) |
| InChIKey | VNHFIKUYUPWMHZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.70 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |