C8H7ClF2N2O2 — CID 115407319
5-chloro-6-(2,2-difluoroethylamino)pyridine-3-carboxylic acid (PubChem CID 115407319) has the molecular formula C8H7ClF2N2O2 and a molecular weight of 236.60 g/mol. Its IUPAC name is 5-chloro-6-(2,2-difluoroethylamino)pyridine-3-carboxylic acid.
| Compound Name | 5-chloro-6-(2,2-difluoroethylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 115407319 |
| Molecular Formula | C8H7ClF2N2O2 |
| Molecular Weight | 236.60 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 5-chloro-6-(2,2-difluoroethylamino)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnc(NCC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C8H7ClF2N2O2/c9-5-1-4(8(14)15)2-12-7(5)13-3-6(10)11/h1-2,6H,3H2,(H,12,13)(H,14,15) |
| InChIKey | UJXJCONDQOLLFR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.60 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |