C13H19Cl2N5 — CID 119114518
N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 119114518) has the molecular formula C13H19Cl2N5 and a molecular weight of 316.24 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 119114518 |
| Molecular Formula | C13H19Cl2N5 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCCNc1ncc(Cl)cc1Cl)N1CCCC1 |
| InChI | InChI=1S/C13H19Cl2N5/c1-16-13(20-6-2-3-7-20)18-5-4-17-12-11(15)8-10(14)9-19-12/h8-9H,2-7H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | RMMCRDONNXQPEH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|