C16H25Cl2IN6O — CID 111929808
1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-ethyl-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide (PubChem CID 111929808) has the molecular formula C16H25Cl2IN6O and a molecular weight of 515.23 g/mol. Its IUPAC name is 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-ethyl-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-ethyl-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111929808 |
| Molecular Formula | C16H25Cl2IN6O |
| Molecular Weight | 515.23 g/mol |
| Exact Mass | 514.05 |
| IUPAC Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-ethyl-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N1CCCC1)NCCNc1ncc(Cl)cc1Cl.I |
| InChI | InChI=1S/C16H24Cl2N6O.HI/c1-2-19-16(23-11-14(25)24-7-3-4-8-24)21-6-5-20-15-13(18)9-12(17)10-22-15;/h9-10H,2-8,11H2,1H3,(H,20,22)(H2,19,21,23);1H |
| InChIKey | WZNAMCYGCGFYRN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|