C17H29Cl2IN6O — CID 111942200
3-[[[2-[(3,5-dichloro-2-pyridinyl)amino]ethylamino]-(ethylamino)methylidene]amino]-N,N-diethylpropanamide;hydroiodide (PubChem CID 111942200) has the molecular formula C17H29Cl2IN6O and a molecular weight of 531.27 g/mol. Its IUPAC name is 3-[[[2-[(3,5-dichloro-2-pyridinyl)amino]ethylamino]-(ethylamino)methylidene]amino]-N,N-diethylpropanamide;hydroiodide.
| Compound Name | 3-[[[2-[(3,5-dichloro-2-pyridinyl)amino]ethylamino]-(ethylamino)methylidene]amino]-N,N-diethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111942200 |
| Molecular Formula | C17H29Cl2IN6O |
| Molecular Weight | 531.27 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | 3-[[[2-[(3,5-dichloro-2-pyridinyl)amino]ethylamino]-(ethylamino)methylidene]amino]-N,N-diethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)N(CC)CC)NCCNc1ncc(Cl)cc1Cl.I |
| InChI | InChI=1S/C17H28Cl2N6O.HI/c1-4-20-17(22-8-7-15(26)25(5-2)6-3)23-10-9-21-16-14(19)11-13(18)12-24-16;/h11-12H,4-10H2,1-3H3,(H,21,24)(H2,20,22,23);1H |
| InChIKey | IYFRNTJCAMYSRL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|