C13H18Cl2F3N5 — CID 109472957
1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109472957) has the molecular formula C13H18Cl2F3N5 and a molecular weight of 372.22 g/mol. Its IUPAC name is 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109472957 |
| Molecular Formula | C13H18Cl2F3N5 |
| Molecular Weight | 372.22 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CCC(F)(F)F)NCCNc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C13H18Cl2F3N5/c1-2-19-12(21-4-3-13(16,17)18)22-6-5-20-11-10(15)7-9(14)8-23-11/h7-8H,2-6H2,1H3,(H,20,23)(H2,19,21,22) |
| InChIKey | XTRARJIWJSXFKJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|