C12H19F3N4S — CID 111987827
1-ethyl-3-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-2-(3,3,3-trifluoropropyl)guanidine (PubChem CID 111987827) has the molecular formula C12H19F3N4S and a molecular weight of 308.37 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-2-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-2-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 111987827 |
| Molecular Formula | C12H19F3N4S |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-ethyl-3-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-2-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CCC(F)(F)F)NCCc1ncc(C)s1 |
| InChI | InChI=1S/C12H19F3N4S/c1-3-16-11(18-7-5-12(13,14)15)17-6-4-10-19-8-9(2)20-10/h8H,3-7H2,1-2H3,(H2,16,17,18) |
| InChIKey | VMBRSVWIGQKPHE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|