C15H21N5S — CID 111790378
1-ethyl-3-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-2-(pyridin-2-ylmethyl)guanidine (PubChem CID 111790378) has the molecular formula C15H21N5S and a molecular weight of 303.43 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-2-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-2-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111790378 |
| Molecular Formula | C15H21N5S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 1-ethyl-3-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-2-(pyridin-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccccn1)NCCc1ncc(C)s1 |
| InChI | InChI=1S/C15H21N5S/c1-3-16-15(20-11-13-6-4-5-8-17-13)18-9-7-14-19-10-12(2)21-14/h4-6,8,10H,3,7,9,11H2,1-2H3,(H2,16,18,20) |
| InChIKey | VHJAIBKPIVCQHS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|