C16H21Cl2IN4S — CID 111793442
2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide (PubChem CID 111793442) has the molecular formula C16H21Cl2IN4S and a molecular weight of 499.25 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111793442 |
| Molecular Formula | C16H21Cl2IN4S |
| Molecular Weight | 499.25 g/mol |
| Exact Mass | 497.99 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1Cl)NCCc1ncc(C)s1.I |
| InChI | InChI=1S/C16H20Cl2N4S.HI/c1-3-19-16(20-7-6-15-21-9-11(2)23-15)22-10-12-4-5-13(17)8-14(12)18;/h4-5,8-9H,3,6-7,10H2,1-2H3,(H2,19,20,22);1H |
| InChIKey | JIXXDGHCKRVFIE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.25 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|