C19H26N4OS — CID 111983161
1-ethyl-3-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-2-[(2-prop-2-enoxyphenyl)methyl]guanidine (PubChem CID 111983161) has the molecular formula C19H26N4OS and a molecular weight of 358.51 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-2-[(2-prop-2-enoxyphenyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-2-[(2-prop-2-enoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111983161 |
| Molecular Formula | C19H26N4OS |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 1-ethyl-3-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-2-[(2-prop-2-enoxyphenyl)methyl]guanidine |
| SMILES | C=CCOc1ccccc1C/N=C(\NCC)NCCc1ncc(C)s1 |
| InChI | InChI=1S/C19H26N4OS/c1-4-12-24-17-9-7-6-8-16(17)14-23-19(20-5-2)21-11-10-18-22-13-15(3)25-18/h4,6-9,13H,1,5,10-12,14H2,2-3H3,(H2,20,21,23) |
| InChIKey | ARIPRRALIUSVCY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|