C16H24Cl2N8 — CID 111698502
2-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine (PubChem CID 111698502) has the molecular formula C16H24Cl2N8 and a molecular weight of 399.33 g/mol. Its IUPAC name is 2-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine.
| Compound Name | 2-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111698502 |
| Molecular Formula | C16H24Cl2N8 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 2-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCNc1ncc(Cl)cc1Cl)NCCn1cnnc1CC |
| InChI | InChI=1S/C16H24Cl2N8/c1-3-14-25-24-11-26(14)8-7-22-16(19-4-2)21-6-5-20-15-13(18)9-12(17)10-23-15/h9-11H,3-8H2,1-2H3,(H,20,23)(H2,19,21,22) |
| InChIKey | FWBQQZJQYBQMNM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|