C17H21F3IN5 — CID 111073144
1-(3,5-dimethylphenyl)-2-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide (PubChem CID 111073144) has the molecular formula C17H21F3IN5 and a molecular weight of 479.29 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-(3,5-dimethylphenyl)-2-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111073144 |
| Molecular Formula | C17H21F3IN5 |
| Molecular Weight | 479.29 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide |
| SMILES | Cc1cc(C)cc(N/C(N)=N/CCNc2ncccc2C(F)(F)F)c1.I |
| InChI | InChI=1S/C17H20F3N5.HI/c1-11-8-12(2)10-13(9-11)25-16(21)24-7-6-23-15-14(17(18,19)20)4-3-5-22-15;/h3-5,8-10H,6-7H2,1-2H3,(H,22,23)(H3,21,24,25);1H |
| InChIKey | ZNXSUOVZRKGBQF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|