C14H14F3N5O — CID 133313933
4-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]pyridine-2-carboxamide (PubChem CID 133313933) has the molecular formula C14H14F3N5O and a molecular weight of 325.29 g/mol. Its IUPAC name is 4-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]pyridine-2-carboxamide.
| Compound Name | 4-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 133313933 |
| Molecular Formula | C14H14F3N5O |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 4-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(NCCNc2ncccc2C(F)(F)F)ccn1 |
| InChI | InChI=1S/C14H14F3N5O/c15-14(16,17)10-2-1-4-21-13(10)22-7-6-19-9-3-5-20-11(8-9)12(18)23/h1-5,8H,6-7H2,(H2,18,23)(H,19,20)(H,21,22) |
| InChIKey | NWXMBMAGAHCVIT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|