C13H21F3IN5 — CID 110920589
1-butan-2-yl-2-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide (PubChem CID 110920589) has the molecular formula C13H21F3IN5 and a molecular weight of 431.24 g/mol. Its IUPAC name is 1-butan-2-yl-2-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-butan-2-yl-2-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110920589 |
| Molecular Formula | C13H21F3IN5 |
| Molecular Weight | 431.24 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 1-butan-2-yl-2-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide |
| SMILES | CCC(C)N/C(N)=N/CCNc1ncccc1C(F)(F)F.I |
| InChI | InChI=1S/C13H20F3N5.HI/c1-3-9(2)21-12(17)20-8-7-19-11-10(13(14,15)16)5-4-6-18-11;/h4-6,9H,3,7-8H2,1-2H3,(H,18,19)(H3,17,20,21);1H |
| InChIKey | NELKTPQYHUWZAR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|