C18H23F3IN5 — CID 111063593
1-(3,5-dimethylphenyl)-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide (PubChem CID 111063593) has the molecular formula C18H23F3IN5 and a molecular weight of 493.32 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide.
| Compound Name | 1-(3,5-dimethylphenyl)-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111063593 |
| Molecular Formula | C18H23F3IN5 |
| Molecular Weight | 493.32 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide |
| SMILES | Cc1cc(C)cc(N/C(N)=N/CCCNc2ccc(C(F)(F)F)cn2)c1.I |
| InChI | InChI=1S/C18H22F3N5.HI/c1-12-8-13(2)10-15(9-12)26-17(22)24-7-3-6-23-16-5-4-14(11-25-16)18(19,20)21;/h4-5,8-11H,3,6-7H2,1-2H3,(H,23,25)(H3,22,24,26);1H |
| InChIKey | CILGAXWIRUGONQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.32 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|