C13H19F3IN5 — CID 75418159
1-cyclopropyl-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide (PubChem CID 75418159) has the molecular formula C13H19F3IN5 and a molecular weight of 429.23 g/mol. Its IUPAC name is 1-cyclopropyl-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 75418159 |
| Molecular Formula | C13H19F3IN5 |
| Molecular Weight | 429.23 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 1-cyclopropyl-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCCNc1ccc(C(F)(F)F)cn1)NC1CC1 |
| InChI | InChI=1S/C13H18F3N5.HI/c14-13(15,16)9-2-5-11(20-8-9)18-6-1-7-19-12(17)21-10-3-4-10;/h2,5,8,10H,1,3-4,6-7H2,(H,18,20)(H3,17,19,21);1H |
| InChIKey | GRYORRCIPLMHRF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.23 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|