C20H32F3N5OS — CID 109439347
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine (PubChem CID 109439347) has the molecular formula C20H32F3N5OS and a molecular weight of 447.57 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 109439347 |
| Molecular Formula | C20H32F3N5OS |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine |
| SMILES | CCN/C(=N\CCCNc1ccc(C(F)(F)F)cn1)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C20H32F3N5OS/c1-3-24-19(28-16-7-5-8-17(13-16)30(29)4-2)26-12-6-11-25-18-10-9-15(14-27-18)20(21,22)23/h9-10,14,16-17H,3-8,11-13H2,1-2H3,(H,25,27)(H2,24,26,28) |
| InChIKey | CHUGLZJYZMVKTO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|