C18H27F3N4O2S — CID 109440547
1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]guanidine (PubChem CID 109440547) has the molecular formula C18H27F3N4O2S and a molecular weight of 420.50 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]guanidine.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]guanidine |
|---|---|
| PubChem CID | 109440547 |
| Molecular Formula | C18H27F3N4O2S |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]guanidine |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCCOc2ccc(C(F)(F)F)cn2)C1 |
| InChI | InChI=1S/C18H27F3N4O2S/c1-3-28(26)15-6-4-5-14(11-15)25-17(22-2)23-9-10-27-16-8-7-13(12-24-16)18(19,20)21/h7-8,12,14-15H,3-6,9-11H2,1-2H3,(H2,22,23,25) |
| InChIKey | LEMAZHOSSVVRCZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|