C14H23F3IN5 — CID 111063615
1,1,3,3-tetramethyl-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide (PubChem CID 111063615) has the molecular formula C14H23F3IN5 and a molecular weight of 445.27 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide.
| Compound Name | 1,1,3,3-tetramethyl-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111063615 |
| Molecular Formula | C14H23F3IN5 |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide |
| SMILES | CN(C)C(=NCCCNc1ccc(C(F)(F)F)cn1)N(C)C.I |
| InChI | InChI=1S/C14H22F3N5.HI/c1-21(2)13(22(3)4)19-9-5-8-18-12-7-6-11(10-20-12)14(15,16)17;/h6-7,10H,5,8-9H2,1-4H3,(H,18,20);1H |
| InChIKey | YNSNRPWMFSOSGU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|