C12H18Cl2N4O2 — CID 110894418
1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-(1-hydroxybutan-2-yl)urea (PubChem CID 110894418) has the molecular formula C12H18Cl2N4O2 and a molecular weight of 321.21 g/mol. Its IUPAC name is 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-(1-hydroxybutan-2-yl)urea.
| Compound Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-(1-hydroxybutan-2-yl)urea |
|---|---|
| PubChem CID | 110894418 |
| Molecular Formula | C12H18Cl2N4O2 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-(1-hydroxybutan-2-yl)urea |
| SMILES | CCC(CO)NC(=O)NCCNc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C12H18Cl2N4O2/c1-2-9(7-19)18-12(20)16-4-3-15-11-10(14)5-8(13)6-17-11/h5-6,9,19H,2-4,7H2,1H3,(H,15,17)(H2,16,18,20) |
| InChIKey | IYDPGJGEKURCSH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|