C14H20Cl2N4O2 — CID 51959977
1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]urea (PubChem CID 51959977) has the molecular formula C14H20Cl2N4O2 and a molecular weight of 347.25 g/mol. Its IUPAC name is 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]urea.
| Compound Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 51959977 |
| Molecular Formula | C14H20Cl2N4O2 |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]urea |
| SMILES | C[C@H](NC(=O)NCCNc1ncc(Cl)cc1Cl)[C@@H]1CCCO1 |
| InChI | InChI=1S/C14H20Cl2N4O2/c1-9(12-3-2-6-22-12)20-14(21)18-5-4-17-13-11(16)7-10(15)8-19-13/h7-9,12H,2-6H2,1H3,(H,17,19)(H2,18,20,21)/t9-,12-/m0/s1 |
| InChIKey | QRNBDJZPGFSDLU-CABZTGNLSA-N |
| XLogP | 2.67 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|