C19H21Cl2N3O3 — CID 55722300
N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-4-(oxolan-2-ylmethoxy)benzamide (PubChem CID 55722300) has the molecular formula C19H21Cl2N3O3 and a molecular weight of 410.30 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-4-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-4-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 55722300 |
| Molecular Formula | C19H21Cl2N3O3 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-4-(oxolan-2-ylmethoxy)benzamide |
| SMILES | O=C(NCCNc1ncc(Cl)cc1Cl)c1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C19H21Cl2N3O3/c20-14-10-17(21)18(24-11-14)22-7-8-23-19(25)13-3-5-15(6-4-13)27-12-16-2-1-9-26-16/h3-6,10-11,16H,1-2,7-9,12H2,(H,22,24)(H,23,25) |
| InChIKey | GEFHCSUMBLZTIV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|