C20H23N3O5 — CID 51221373
N-[2-(2-nitroanilino)ethyl]-4-(oxolan-2-ylmethoxy)benzamide (PubChem CID 51221373) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is N-[2-(2-nitroanilino)ethyl]-4-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-[2-(2-nitroanilino)ethyl]-4-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 51221373 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-[2-(2-nitroanilino)ethyl]-4-(oxolan-2-ylmethoxy)benzamide |
| SMILES | O=C(NCCNc1ccccc1[N+](=O)[O-])c1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C20H23N3O5/c24-20(22-12-11-21-18-5-1-2-6-19(18)23(25)26)15-7-9-16(10-8-15)28-14-17-4-3-13-27-17/h1-2,5-10,17,21H,3-4,11-14H2,(H,22,24) |
| InChIKey | LBSIPWYYGXCUBZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|