C18H30IN5O4 — CID 111407862
2-methyl-1-[2-(2-nitroanilino)ethyl]-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111407862) has the molecular formula C18H30IN5O4 and a molecular weight of 507.37 g/mol. Its IUPAC name is 2-methyl-1-[2-(2-nitroanilino)ethyl]-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(2-nitroanilino)ethyl]-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111407862 |
| Molecular Formula | C18H30IN5O4 |
| Molecular Weight | 507.37 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | 2-methyl-1-[2-(2-nitroanilino)ethyl]-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CCCO1)NCCNc1ccccc1[N+](=O)[O-].I |
| InChI | InChI=1S/C18H29N5O4.HI/c1-19-18(21-9-5-12-26-14-15-6-4-13-27-15)22-11-10-20-16-7-2-3-8-17(16)23(24)25;/h2-3,7-8,15,20H,4-6,9-14H2,1H3,(H2,19,21,22);1H |
| InChIKey | MKCZVRBFRWXWMM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|