C20H33N5O4 — CID 111643010
1-ethyl-3-[2-(2-nitroanilino)ethyl]-2-[3-(oxan-4-ylmethoxy)propyl]guanidine (PubChem CID 111643010) has the molecular formula C20H33N5O4 and a molecular weight of 407.52 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-nitroanilino)ethyl]-2-[3-(oxan-4-ylmethoxy)propyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(2-nitroanilino)ethyl]-2-[3-(oxan-4-ylmethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111643010 |
| Molecular Formula | C20H33N5O4 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | 1-ethyl-3-[2-(2-nitroanilino)ethyl]-2-[3-(oxan-4-ylmethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CCCOCC1CCOCC1)NCCNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H33N5O4/c1-2-21-20(23-10-5-13-29-16-17-8-14-28-15-9-17)24-12-11-22-18-6-3-4-7-19(18)25(26)27/h3-4,6-7,17,22H,2,5,8-16H2,1H3,(H2,21,23,24) |
| InChIKey | SEIHUCGNXUIDDQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|