C15H25N5O2 — CID 111150068
2-butyl-1-ethyl-3-[2-(2-nitroanilino)ethyl]guanidine (PubChem CID 111150068) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 2-butyl-1-ethyl-3-[2-(2-nitroanilino)ethyl]guanidine.
| Compound Name | 2-butyl-1-ethyl-3-[2-(2-nitroanilino)ethyl]guanidine |
|---|---|
| PubChem CID | 111150068 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 2-butyl-1-ethyl-3-[2-(2-nitroanilino)ethyl]guanidine |
| SMILES | CCCC/N=C(\NCC)NCCNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H25N5O2/c1-3-5-10-18-15(16-4-2)19-12-11-17-13-8-6-7-9-14(13)20(21)22/h6-9,17H,3-5,10-12H2,1-2H3,(H2,16,18,19) |
| InChIKey | RWPMVYFDUJOINV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|