C19H28N6O3 — CID 111592567
2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(2-nitroanilino)ethyl]guanidine (PubChem CID 111592567) has the molecular formula C19H28N6O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(2-nitroanilino)ethyl]guanidine.
| Compound Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(2-nitroanilino)ethyl]guanidine |
|---|---|
| PubChem CID | 111592567 |
| Molecular Formula | C19H28N6O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(2-nitroanilino)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(C(C)(C)C)o1)NCCNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H28N6O3/c1-5-20-18(24-13-17-23-12-16(28-17)19(2,3)4)22-11-10-21-14-8-6-7-9-15(14)25(26)27/h6-9,12,21H,5,10-11,13H2,1-4H3,(H2,20,22,24) |
| InChIKey | PYQNGSWHJCPKNW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|