C18H26IN5O3 — CID 111593429
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[(2-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111593429) has the molecular formula C18H26IN5O3 and a molecular weight of 487.34 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[(2-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[(2-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111593429 |
| Molecular Formula | C18H26IN5O3 |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[(2-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1[N+](=O)[O-])NCc1ncc(C(C)(C)C)o1.I |
| InChI | InChI=1S/C18H25N5O3.HI/c1-5-19-17(21-10-13-8-6-7-9-14(13)23(24)25)22-12-16-20-11-15(26-16)18(2,3)4;/h6-9,11H,5,10,12H2,1-4H3,(H2,19,21,22);1H |
| InChIKey | MXELJNHAUNNVGG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|